Names:
maltyl isobutyrate
SMILES:
CC1=C(C(=O)C=CO1)OC(=O)C(C)C
Aroma Description:
berry, caramellic, cotton_candy, fruity, strawberry, sweet, tropical1
| Receptor | Expression | log10 EC50 | Adj. Top | Antagonist? | Correlated Perceptual Qualities |
|---|---|---|---|---|---|
| OR2T10 | 92 | -5.6 2 | 9.5 2 | berry, sweet, candy, cotton_candy, cinnamon, lavender, strawberry, bergamot, lime, warm | |
| OR5AC2 | 76 | -5.8 2 | 7 2 | cotton_candy, carnation, sweet, berry, caramellic, strawberry, chocolate, natural, clove, plum | |
| OR5M3 | 92 | -3.91 3 | - | cotton_candy, brown_sugar, caramellic, burnt_sugar, maple | |
| OR2G2 | 38 | -5.8 2 | 4 2 | sweet, candy, cinnamon, berry, warm | |
| OR1G1 | 61 | -5.7 2 | 3.5 2 | waxy, sweet, citrus, tart, fresh, orange, aldehydic, fatty, rose, floral | |
| OR8D1 | 96 | - | 0 3 |
SMILES:
CC1=C(C(=O)C=CO1)OC(=O)C(C)C
Aroma Description:
berry, caramellic, cotton_candy, fruity, strawberry, sweet, tropical
| Receptor | Expr.% | Agonist? | Dock Score | Known agonist | Correlated Perceptual Qualities |
|---|
Dock Score is a measure of how strongly the algorithm thinks the odorant is likely to be an agonist of the receptor.
Receptors in italics are "orphans", i.e. receptors whose agonists have not been identified experimentally.
1.) The Good Scents Company
2.) D. Gonzalez-Kristeller, J.B.P. do Nascimento, P.A.F. Galante, B. Malnic, Identification of agonists for a group of human odorant receptors, Front. Pharmacol. 6 (2015)
3.) Roger Emter, Christel Merillat, Fiona Buchli, Felix Flachsmann, Andreas Natsch. Decoding human olfaction by high heterologous expression of odorant receptors detecting signature odorants. Current Biology, October 10, 2025