ethyl methylphenylglycidate, ethyl 3-methyl-3-phenyloxirane-2-carboxylate
SMILES:
CC(C2C(OCC)=O)(O2)C1=CC=CC=C1
Aroma Description:
sweet, fruity, strawberry, floral, honey, fatty1
Notes:
The (+) isomer has a very recognizably strawberry aroma, while the (-) isomer smells faint and non-specifically fruity.2
ethyl methylphenylglycidate, ethyl 3-methyl-3-phenyloxirane-2-carboxylate
SMILES:
CC(C2C(OCC)=O)(O2)C1=CC=CC=C1
Aroma Description:
sweet, fruity, strawberry, floral, honey, fatty
| Receptor | Expr.% | Agonist? | Dock Score | Known agonist | Correlated Perceptual Qualities |
|---|
Dock Score is a measure of how strongly the algorithm thinks the odorant is likely to be an agonist of the receptor.
Receptors in italics are "orphans", i.e. receptors whose agonists have not been identified experimentally.