Names:
alpha-damascone
SMILES:
C/C=C/C(=O)C1C(=CCCC1(C)C)C
Aroma Description:
floral, rose, apple, fruity, black_currant, sweet, green, berry1
| Receptor | Expression | log10 EC50 | Adj. Top | Antagonist? | Correlated Perceptual Qualities |
|---|---|---|---|---|---|
| OR1L3 | 100 | -4.6 2 | 9 2 | chocolate, sweet, vanilla, rose, berry, floral, apple, creamy | |
| OR5AC2 | 76 | -4.7 2 | 8 2 | cotton_candy, carnation, berry, sweet, chocolate, strawberry, caramellic, plum, clove, natural | |
| OR2G2 | 38 | -4.8 2 | 6.5 2 | sweet, candy, berry, cinnamon, warm, vanilla, cotton_candy, strawberry | |
| OR2T10 | 92 | -4.7 2 | 6.7 2 | berry, bergamot, cotton_candy, lavender, strawberry, candy, lime, sweet, chocolate, warm | |
| OR2T34 | ? | -4.9 2 | 5.8 2 | fennel, candy, sweet, anise, apple, plum, ozone, warm, chocolate, cinnamon | |
| OR2M4 | 96 | -4.8 2 | 4.7 2 | fennel, naphthyl, anise, narcissus, sweet | |
| OR2T11 | 96 | - | 0 3 | Y | |
| OR10A6 | 100 | - | 0 4 | ||
| OR11H4 | 100 | - | 0 4 | ||
| OR2AG2 | 100 | - | 0 4 |
SMILES:
C/C=C/C(=O)C1C(=CCCC1(C)C)C
Aroma Description:
floral, rose, apple, fruity, black_currant, sweet, green, berry
| Receptor | Expr.% | Agonist? | Dock Score | Known agonist | Correlated Perceptual Qualities |
|---|
Dock Score is a measure of how strongly the algorithm thinks the odorant is likely to be an agonist of the receptor.
Receptors in italics are "orphans", i.e. receptors whose agonists have not been identified experimentally.
1.) The Good Scents Company
2.) D. Gonzalez-Kristeller, J.B.P. do Nascimento, P.A.F. Galante, B. Malnic, Identification of agonists for a group of human odorant receptors, Front. Pharmacol. 6 (2015)
3.) Antagonistic interactions between odorants alter human odor perception Yosuke Fukutani, Masashi Abe, Haruka Saito, Ryo Eguchi, Toshiaki Tazawa, Claire A. de March, Masafumi Yohda, Hiroaki Matsunami bioRxiv 2022.08.02.502184; doi: https://doi.org/10.1101/2022.08.02.502184
4.) Duroux R, Mandeau A, Guiraudie-Capraz G, Quesnel Y, Loing E. A Rose Extract Protects the Skin against Stress Mediators: A Potential Role of Olfactory Receptors. Molecules. 2020 Oct 16;25(20):4743. doi: 10.3390/molecules25204743. PMID: 33081083; PMCID: PMC7587601.