SMILES:
C1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O
Aroma Description:
| Receptor | log10 EC50 | Adj. Top | Antagonist? | Hypothesized PQ | Associated Perceptual Qualities (PQs) |
|---|---|---|---|---|---|
| OR10G3 | - | 0 1 | |||
| OR10G7 | - | 0 1 | |||
| OR10J5 | - | 0 1 | |||
| OR11A1 | - | 0 1 | |||
| OR1C1 | - | 0 1 | |||
| OR2A25 | - | 0 1 | |||
| OR2J2 | - | 0 1 | |||
| OR2J3 | - | 0 1 | |||
| OR2W1 | - | 0 1 | |||
| OR51E1 | - | 0 1 | |||
| OR51L1 | - | 0 1 | |||
| OR56A4 | - | 0 1 | |||
| OR5K1 | - | 0 1 | |||
| OR8D1 | - | 0 1 | |||
| OR8K3 | - | 0 1 | |||
| OR2B11 | - | -0.6667 1 | |||
| OR1A1 | - | -1.5667 1 | |||
| OR5P3 | - | -1.5667 1 |
1.) Adipietro KA, Mainland JD, Matsunami H (2012) Functional Evolution of Mammalian Odorant Receptors. PLoS Genet 8(7): e1002821. doi:10.1371/ journal.pgen.1002821
References for aroma perceptual qualities should not be taken to indicate that the authors of outside studies necessarily assigned aroma notes to the neurons that receive input from any given receptor. Rather, the findings of outside studies often constitute the information on which we base our own perceptual quality assignments.